C22H34N2O2 — CID 42710688
N-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-pentylpentanamide (PubChem CID 42710688) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-pentylpentanamide.
| Compound Name | N-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-pentylpentanamide |
|---|---|
| PubChem CID | 42710688 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | N-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-pentylpentanamide |
| SMILES | CCCCCN(CC(=O)N1CCc2ccccc2C1C)C(=O)CCCC |
| InChI | InChI=1S/C22H34N2O2/c1-4-6-10-15-23(21(25)13-7-5-2)17-22(26)24-16-14-19-11-8-9-12-20(19)18(24)3/h8-9,11-12,18H,4-7,10,13-17H2,1-3H3 |
| InChIKey | FRNZAXYJCYEPPH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|