C25H32BrN3O2 — CID 42710904
3-(2-bromophenyl)-1-hexyl-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea (PubChem CID 42710904) has the molecular formula C25H32BrN3O2 and a molecular weight of 486.45 g/mol. Its IUPAC name is 3-(2-bromophenyl)-1-hexyl-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea.
| Compound Name | 3-(2-bromophenyl)-1-hexyl-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 42710904 |
| Molecular Formula | C25H32BrN3O2 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 3-(2-bromophenyl)-1-hexyl-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea |
| SMILES | CCCCCCN(CC(=O)N1CCc2ccccc2C1C)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C25H32BrN3O2/c1-3-4-5-10-16-28(25(31)27-23-14-9-8-13-22(23)26)18-24(30)29-17-15-20-11-6-7-12-21(20)19(29)2/h6-9,11-14,19H,3-5,10,15-18H2,1-2H3,(H,27,31) |
| InChIKey | MPBSLKWSIGTNCC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|