C27H37N3O2 — CID 42710908
3-(2,6-dimethylphenyl)-1-hexyl-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea (PubChem CID 42710908) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-1-hexyl-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea.
| Compound Name | 3-(2,6-dimethylphenyl)-1-hexyl-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 42710908 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-1-hexyl-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea |
| SMILES | CCCCCCN(CC(=O)N1CCc2ccccc2C1C)C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C27H37N3O2/c1-5-6-7-10-17-29(27(32)28-26-20(2)12-11-13-21(26)3)19-25(31)30-18-16-23-14-8-9-15-24(23)22(30)4/h8-9,11-15,22H,5-7,10,16-19H2,1-4H3,(H,28,32) |
| InChIKey | SFEZCDJVJCPLNA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|