C26H35N3O3 — CID 3400414
1-hexyl-3-(4-methoxyphenyl)-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea (PubChem CID 3400414) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 1-hexyl-3-(4-methoxyphenyl)-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea.
| Compound Name | 1-hexyl-3-(4-methoxyphenyl)-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 3400414 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 1-hexyl-3-(4-methoxyphenyl)-1-[2-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]urea |
| SMILES | CCCCCCN(CC(=O)N1CCc2ccccc2C1C)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H35N3O3/c1-4-5-6-9-17-28(26(31)27-22-12-14-23(32-3)15-13-22)19-25(30)29-18-16-21-10-7-8-11-24(21)20(29)2/h7-8,10-15,20H,4-6,9,16-19H2,1-3H3,(H,27,31) |
| InChIKey | BGXVOZGLJLNCJW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|