C15H21BrN2O2 — CID 113166810
2-[acetyl(pentyl)amino]-N-(2-bromophenyl)acetamide (PubChem CID 113166810) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-[acetyl(pentyl)amino]-N-(2-bromophenyl)acetamide.
| Compound Name | 2-[acetyl(pentyl)amino]-N-(2-bromophenyl)acetamide |
|---|---|
| PubChem CID | 113166810 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-[acetyl(pentyl)amino]-N-(2-bromophenyl)acetamide |
| SMILES | CCCCCN(CC(=O)Nc1ccccc1Br)C(C)=O |
| InChI | InChI=1S/C15H21BrN2O2/c1-3-4-7-10-18(12(2)19)11-15(20)17-14-9-6-5-8-13(14)16/h5-6,8-9H,3-4,7,10-11H2,1-2H3,(H,17,20) |
| InChIKey | UCSCFYUMJPPGLX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|