C30H44N2O2S — CID 98403289
N-[2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-pentylnonanamide (PubChem CID 98403289) has the molecular formula C30H44N2O2S and a molecular weight of 496.76 g/mol. Its IUPAC name is N-[2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-pentylnonanamide.
| Compound Name | N-[2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-pentylnonanamide |
|---|---|
| PubChem CID | 98403289 |
| Molecular Formula | C30H44N2O2S |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | N-[2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-pentylnonanamide |
| SMILES | CCCCCCCCC(=O)N(CCCCC)CC(=O)N1CCc2sccc2[C@@H]1c1ccccc1C |
| InChI | InChI=1S/C30H44N2O2S/c1-4-6-8-9-10-11-17-28(33)31(20-14-7-5-2)23-29(34)32-21-18-27-26(19-22-35-27)30(32)25-16-13-12-15-24(25)3/h12-13,15-16,19,22,30H,4-11,14,17-18,20-21,23H2,1-3H3/t30-/m0/s1 |
| InChIKey | MKHVIHCGNXNUJA-PMERELPUSA-N |
| XLogP | 7.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|