C28H40N2O3S — CID 4561624
N-(3-methoxypropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]nonanamide (PubChem CID 4561624) has the molecular formula C28H40N2O3S and a molecular weight of 484.71 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]nonanamide.
| Compound Name | N-(3-methoxypropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]nonanamide |
|---|---|
| PubChem CID | 4561624 |
| Molecular Formula | C28H40N2O3S |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | N-(3-methoxypropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCCOC)CC(=O)N1CCc2sccc2C1c1ccccc1 |
| InChI | InChI=1S/C28H40N2O3S/c1-3-4-5-6-7-11-15-26(31)29(18-12-20-33-2)22-27(32)30-19-16-25-24(17-21-34-25)28(30)23-13-9-8-10-14-23/h8-10,13-14,17,21,28H,3-7,11-12,15-16,18-20,22H2,1-2H3 |
| InChIKey | PZYWBGQEZFOMPT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|