C26H36N2O3S — CID 4210819
N-(2-methoxyethyl)-N-[2-[4-(4-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]heptanamide (PubChem CID 4210819) has the molecular formula C26H36N2O3S and a molecular weight of 456.65 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[2-[4-(4-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]heptanamide.
| Compound Name | N-(2-methoxyethyl)-N-[2-[4-(4-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]heptanamide |
|---|---|
| PubChem CID | 4210819 |
| Molecular Formula | C26H36N2O3S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | N-(2-methoxyethyl)-N-[2-[4-(4-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]heptanamide |
| SMILES | CCCCCCC(=O)N(CCOC)CC(=O)N1CCc2sccc2C1c1ccc(C)cc1 |
| InChI | InChI=1S/C26H36N2O3S/c1-4-5-6-7-8-24(29)27(16-17-31-3)19-25(30)28-15-13-23-22(14-18-32-23)26(28)21-11-9-20(2)10-12-21/h9-12,14,18,26H,4-8,13,15-17,19H2,1-3H3 |
| InChIKey | WZLARPSNURSKHC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|