C24H31FN2O2S — CID 3915347
N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-propylhexanamide (PubChem CID 3915347) has the molecular formula C24H31FN2O2S and a molecular weight of 430.59 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-propylhexanamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-propylhexanamide |
|---|---|
| PubChem CID | 3915347 |
| Molecular Formula | C24H31FN2O2S |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-N-propylhexanamide |
| SMILES | CCCCCC(=O)N(CCC)CC(=O)N1CCc2sccc2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H31FN2O2S/c1-3-5-6-7-22(28)26(14-4-2)17-23(29)27-15-12-21-20(13-16-30-21)24(27)18-8-10-19(25)11-9-18/h8-11,13,16,24H,3-7,12,14-15,17H2,1-2H3 |
| InChIKey | MUKZPPMUUIJBIP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|