C25H34N2O2S — CID 7237908
N-butyl-N-[2-oxo-2-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]hexanamide (PubChem CID 7237908) has the molecular formula C25H34N2O2S and a molecular weight of 426.63 g/mol. Its IUPAC name is N-butyl-N-[2-oxo-2-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]hexanamide.
| Compound Name | N-butyl-N-[2-oxo-2-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]hexanamide |
|---|---|
| PubChem CID | 7237908 |
| Molecular Formula | C25H34N2O2S |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-butyl-N-[2-oxo-2-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]hexanamide |
| SMILES | CCCCCC(=O)N(CCCC)CC(=O)N1CCc2sccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H34N2O2S/c1-3-5-8-13-23(28)26(16-6-4-2)19-24(29)27-17-14-22-21(15-18-30-22)25(27)20-11-9-7-10-12-20/h7,9-12,15,18,25H,3-6,8,13-14,16-17,19H2,1-2H3/t25-/m1/s1 |
| InChIKey | ZVMDANDBYHWQQJ-RUZDIDTESA-N |
| XLogP | 5.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|