C24H32N2O3S — CID 7412345
N-(3-ethoxypropyl)-N-[2-oxo-2-[(4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]butanamide (PubChem CID 7412345) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N-[2-oxo-2-[(4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]butanamide.
| Compound Name | N-(3-ethoxypropyl)-N-[2-oxo-2-[(4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 7412345 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-(3-ethoxypropyl)-N-[2-oxo-2-[(4S)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethyl]butanamide |
| SMILES | CCCC(=O)N(CCCOCC)CC(=O)N1CCc2sccc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H32N2O3S/c1-3-9-22(27)25(14-8-16-29-4-2)18-23(28)26-15-12-21-20(13-17-30-21)24(26)19-10-6-5-7-11-19/h5-7,10-11,13,17,24H,3-4,8-9,12,14-16,18H2,1-2H3/t24-/m0/s1 |
| InChIKey | XIVXZEAJOPKUJP-DEOSSOPVSA-N |
| XLogP | 4.28 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|