C29H42N2O3S — CID 3909966
N-(3-ethoxypropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]nonanamide (PubChem CID 3909966) has the molecular formula C29H42N2O3S and a molecular weight of 498.73 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]nonanamide.
| Compound Name | N-(3-ethoxypropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]nonanamide |
|---|---|
| PubChem CID | 3909966 |
| Molecular Formula | C29H42N2O3S |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | N-(3-ethoxypropyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCCOCC)CC(=O)N1CCc2sccc2C1c1ccccc1 |
| InChI | InChI=1S/C29H42N2O3S/c1-3-5-6-7-8-12-16-27(32)30(19-13-21-34-4-2)23-28(33)31-20-17-26-25(18-22-35-26)29(31)24-14-10-9-11-15-24/h9-11,14-15,18,22,29H,3-8,12-13,16-17,19-21,23H2,1-2H3 |
| InChIKey | CYBBPELNYWNFGI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|