C28H32N2O5 — CID 123273688
2-[2-[1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]octanoic acid (PubChem CID 123273688) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-[2-[1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]octanoic acid.
| Compound Name | 2-[2-[1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]octanoic acid |
|---|---|
| PubChem CID | 123273688 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 2-[2-[1-[(1,3-dioxoisoindol-2-yl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]octanoic acid |
| SMILES | CCCCCCC(CC(=O)N1CCc2ccccc2C1CN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C28H32N2O5/c1-2-3-4-5-11-20(28(34)35)17-25(31)29-16-15-19-10-6-7-12-21(19)24(29)18-30-26(32)22-13-8-9-14-23(22)27(30)33/h6-10,12-14,20,24H,2-5,11,15-18H2,1H3,(H,34,35) |
| InChIKey | ONKICKPYMMOFHY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|