C21H25N2O3P — CID 11850908
2-diethoxyphosphoryl-3-methyl-5,6-diphenyl-1,2-dihydropyrazine (PubChem CID 11850908) has the molecular formula C21H25N2O3P and a molecular weight of 384.42 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-3-methyl-5,6-diphenyl-1,2-dihydropyrazine.
| Compound Name | 2-diethoxyphosphoryl-3-methyl-5,6-diphenyl-1,2-dihydropyrazine |
|---|---|
| PubChem CID | 11850908 |
| Molecular Formula | C21H25N2O3P |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-diethoxyphosphoryl-3-methyl-5,6-diphenyl-1,2-dihydropyrazine |
| SMILES | CCOP(=O)(OCC)C1NC(c2ccccc2)=C(c2ccccc2)N=C1C |
| InChI | InChI=1S/C21H25N2O3P/c1-4-25-27(24,26-5-2)21-16(3)22-19(17-12-8-6-9-13-17)20(23-21)18-14-10-7-11-15-18/h6-15,21,23H,4-5H2,1-3H3 |
| InChIKey | MKEBYUKZWBUSGY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|