C18H20NO4PS — CID 102502025
5-diethoxyphosphoryl-6-methyl-3-phenyl-5H-thieno[2,3-b]pyridin-4-one (PubChem CID 102502025) has the molecular formula C18H20NO4PS and a molecular weight of 377.40 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-6-methyl-3-phenyl-5H-thieno[2,3-b]pyridin-4-one.
| Compound Name | 5-diethoxyphosphoryl-6-methyl-3-phenyl-5H-thieno[2,3-b]pyridin-4-one |
|---|---|
| PubChem CID | 102502025 |
| Molecular Formula | C18H20NO4PS |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 5-diethoxyphosphoryl-6-methyl-3-phenyl-5H-thieno[2,3-b]pyridin-4-one |
| SMILES | CCOP(=O)(OCC)C1C(=O)c2c(-c3ccccc3)csc2N=C1C |
| InChI | InChI=1S/C18H20NO4PS/c1-4-22-24(21,23-5-2)17-12(3)19-18-15(16(17)20)14(11-25-18)13-9-7-6-8-10-13/h6-11,17H,4-5H2,1-3H3 |
| InChIKey | STYBXBFZMVLMIL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|