C12H16NO6PS — CID 122210329
5-diethoxyphosphoryl-4-phenyl-5H-oxathiazole 2,2-dioxide (PubChem CID 122210329) has the molecular formula C12H16NO6PS and a molecular weight of 333.30 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-4-phenyl-5H-oxathiazole 2,2-dioxide.
| Compound Name | 5-diethoxyphosphoryl-4-phenyl-5H-oxathiazole 2,2-dioxide |
|---|---|
| PubChem CID | 122210329 |
| Molecular Formula | C12H16NO6PS |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 5-diethoxyphosphoryl-4-phenyl-5H-oxathiazole 2,2-dioxide |
| SMILES | CCOP(=O)(OCC)C1OS(=O)(=O)N=C1c1ccccc1 |
| InChI | InChI=1S/C12H16NO6PS/c1-3-17-20(14,18-4-2)12-11(13-21(15,16)19-12)10-8-6-5-7-9-10/h5-9,12H,3-4H2,1-2H3 |
| InChIKey | TZNICHXYAQZJQH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|