C43H37F6PS2 — CID 10974714
4-[(1E,3E)-5-[2,6-bis(2-methylphenyl)thiopyran-4-ylidene]penta-1,3-dienyl]-2,6-bis(2-methylphenyl)thiopyrylium hexafluorophosphate (PubChem CID 10974714) has the molecular formula C43H37F6PS2 and a molecular weight of 762.87 g/mol. Its IUPAC name is 4-[(1E,3E)-5-[2,6-bis(2-methylphenyl)thiopyran-4-ylidene]penta-1,3-dienyl]-2,6-bis(2-methylphenyl)thiopyrylium hexafluorophosphate.
| Compound Name | 4-[(1E,3E)-5-[2,6-bis(2-methylphenyl)thiopyran-4-ylidene]penta-1,3-dienyl]-2,6-bis(2-methylphenyl)thiopyrylium hexafluorophosphate |
|---|---|
| PubChem CID | 10974714 |
| Molecular Formula | C43H37F6PS2 |
| Molecular Weight | 762.87 g/mol |
| Exact Mass | 762.20 |
| IUPAC Name | 4-[(1E,3E)-5-[2,6-bis(2-methylphenyl)thiopyran-4-ylidene]penta-1,3-dienyl]-2,6-bis(2-methylphenyl)thiopyrylium hexafluorophosphate |
| SMILES | Cc1ccccc1C1=CC(=C/C=C/C=C/c2cc(-c3ccccc3C)[s+]c(-c3ccccc3C)c2)C=C(c2ccccc2C)S1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C43H37S2.F6P/c1-30-16-8-12-22-36(30)40-26-34(27-41(44-40)37-23-13-9-17-31(37)2)20-6-5-7-21-35-28-42(38-24-14-10-18-32(38)3)45-43(29-35)39-25-15-11-19-33(39)4;1-7(2,3,4,5)6/h5-29H,1-4H3;/q+1;-1 |
| InChIKey | AEXZXRCRCUFULA-UHFFFAOYSA-N |
| XLogP | 16.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.87 |
| LogP ≤ 5 | 16.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|