C20H16O2W — CID 11786839
[2-(2,6-diphenylpyran-4-ylidene)-1-methoxyethylidene]tungsten (PubChem CID 11786839) has the molecular formula C20H16O2W and a molecular weight of 472.19 g/mol. Its IUPAC name is [2-(2,6-diphenylpyran-4-ylidene)-1-methoxyethylidene]tungsten.
| Compound Name | [2-(2,6-diphenylpyran-4-ylidene)-1-methoxyethylidene]tungsten |
|---|---|
| PubChem CID | 11786839 |
| Molecular Formula | C20H16O2W |
| Molecular Weight | 472.19 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | [2-(2,6-diphenylpyran-4-ylidene)-1-methoxyethylidene]tungsten |
| SMILES | COC(=[W])C=C1C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C20H16O2.W/c1-21-13-12-16-14-19(17-8-4-2-5-9-17)22-20(15-16)18-10-6-3-7-11-18;/h2-12,14-15H,1H3; |
| InChIKey | YLTQMOMKNJCSPW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |