C34H26ClNO5 — CID 134911317
(3Z)-3-[2-(2,6-diphenylpyran-4-ylidene)-1-phenylethylidene]-1-methylindol-1-ium perchlorate (PubChem CID 134911317) has the molecular formula C34H26ClNO5 and a molecular weight of 564.04 g/mol. Its IUPAC name is (3Z)-3-[2-(2,6-diphenylpyran-4-ylidene)-1-phenylethylidene]-1-methylindol-1-ium perchlorate.
| Compound Name | (3Z)-3-[2-(2,6-diphenylpyran-4-ylidene)-1-phenylethylidene]-1-methylindol-1-ium perchlorate |
|---|---|
| PubChem CID | 134911317 |
| Molecular Formula | C34H26ClNO5 |
| Molecular Weight | 564.04 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | (3Z)-3-[2-(2,6-diphenylpyran-4-ylidene)-1-phenylethylidene]-1-methylindol-1-ium perchlorate |
| SMILES | C[N+]1=C/C(=C(/C=C2C=C(c3ccccc3)OC(c3ccccc3)=C2)c2ccccc2)c2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C34H26NO.ClHO4/c1-35-24-31(29-19-11-12-20-32(29)35)30(26-13-5-2-6-14-26)21-25-22-33(27-15-7-3-8-16-27)36-34(23-25)28-17-9-4-10-18-28;2-1(3,4)5/h2-24H,1H3;(H,2,3,4,5)/q+1;/p-1/b31-30+; |
| InChIKey | JCFKJGVCKGJISW-FJISBNMDSA-M |
| XLogP | 3.24 |
| TPSA | 104.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.04 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|