C31H26ClNO5 — CID 171154862
benzyl-[2-(3-methyl-2-phenylchromen-4-ylidene)-1-phenylethylidene]azanium perchlorate (PubChem CID 171154862) has the molecular formula C31H26ClNO5 and a molecular weight of 528.00 g/mol. Its IUPAC name is benzyl-[2-(3-methyl-2-phenylchromen-4-ylidene)-1-phenylethylidene]azanium perchlorate.
| Compound Name | benzyl-[2-(3-methyl-2-phenylchromen-4-ylidene)-1-phenylethylidene]azanium perchlorate |
|---|---|
| PubChem CID | 171154862 |
| Molecular Formula | C31H26ClNO5 |
| Molecular Weight | 528.00 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | benzyl-[2-(3-methyl-2-phenylchromen-4-ylidene)-1-phenylethylidene]azanium perchlorate |
| SMILES | CC1=C(c2ccccc2)Oc2ccccc2C1=C/C(=[NH+]/Cc1ccccc1)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C31H25NO.ClHO4/c1-23-28(27-19-11-12-20-30(27)33-31(23)26-17-9-4-10-18-26)21-29(25-15-7-3-8-16-25)32-22-24-13-5-2-6-14-24;2-1(3,4)5/h2-21H,22H2,1H3;(H,2,3,4,5)/b28-21?,32-29-; |
| InChIKey | NPELCAJVWHRPSP-ZXYOEARXSA-N |
| XLogP | 0.91 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.00 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|