C35H35BF4N2 — CID 10995385
benzyl-[(2E,4E,6E)-7-(benzylamino)-1,7-bis(4-methylphenyl)hepta-2,4,6-trienylidene]azanium tetrafluoroborate (PubChem CID 10995385) has the molecular formula C35H35BF4N2 and a molecular weight of 570.48 g/mol. Its IUPAC name is benzyl-[(2E,4E,6E)-7-(benzylamino)-1,7-bis(4-methylphenyl)hepta-2,4,6-trienylidene]azanium tetrafluoroborate.
| Compound Name | benzyl-[(2E,4E,6E)-7-(benzylamino)-1,7-bis(4-methylphenyl)hepta-2,4,6-trienylidene]azanium tetrafluoroborate |
|---|---|
| PubChem CID | 10995385 |
| Molecular Formula | C35H35BF4N2 |
| Molecular Weight | 570.48 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | benzyl-[(2E,4E,6E)-7-(benzylamino)-1,7-bis(4-methylphenyl)hepta-2,4,6-trienylidene]azanium tetrafluoroborate |
| SMILES | Cc1ccc(/C(=C\C=C\C=C\C(=[NH+]/Cc2ccccc2)c2ccc(C)cc2)NCc2ccccc2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C35H34N2.BF4/c1-28-18-22-32(23-19-28)34(36-26-30-12-6-3-7-13-30)16-10-5-11-17-35(33-24-20-29(2)21-25-33)37-27-31-14-8-4-9-15-31;2-1(3,4)5/h3-25,36H,26-27H2,1-2H3;/q;-1/p+1/b10-5+,17-11+,34-16+,37-35+; |
| InChIKey | OBSNSUJGXWPMCQ-SYMFFMAFSA-O |
| XLogP | 7.62 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.48 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|