C19H19NO — CID 176530127
N-benzyl-2-(4-methylphenyl)penta-2,3-dienamide (PubChem CID 176530127) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is N-benzyl-2-(4-methylphenyl)penta-2,3-dienamide.
| Compound Name | N-benzyl-2-(4-methylphenyl)penta-2,3-dienamide |
|---|---|
| PubChem CID | 176530127 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-benzyl-2-(4-methylphenyl)penta-2,3-dienamide |
| SMILES | CC=C=C(C(=O)NCc1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H19NO/c1-3-7-18(17-12-10-15(2)11-13-17)19(21)20-14-16-8-5-4-6-9-16/h3-6,8-13H,14H2,1-2H3,(H,20,21) |
| InChIKey | HCAKADCIEIDKRL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|