C26H25N3O — CID 143292232
N'-amino-4-[[(4E)-2-phenyl-4-propylidenechromen-3-yl]methyl]benzenecarboximidamide (PubChem CID 143292232) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is N'-amino-4-[[(4E)-2-phenyl-4-propylidenechromen-3-yl]methyl]benzenecarboximidamide.
| Compound Name | N'-amino-4-[[(4E)-2-phenyl-4-propylidenechromen-3-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 143292232 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N'-amino-4-[[(4E)-2-phenyl-4-propylidenechromen-3-yl]methyl]benzenecarboximidamide |
| SMILES | CC/C=C1\C(Cc2ccc(/C(N)=N/N)cc2)=C(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C26H25N3O/c1-2-8-21-22-11-6-7-12-24(22)30-25(19-9-4-3-5-10-19)23(21)17-18-13-15-20(16-14-18)26(27)29-28/h3-16H,2,17,28H2,1H3,(H2,27,29)/b21-8- |
| InChIKey | CYZFVMFWFPYGFR-WNFQYIGGSA-N |
| XLogP | 5.11 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|