C34H29N — CID 142425146
(1Z,3E)-5-[4-(8-methylnaphthalen-1-yl)phenyl]-1,3-diphenylpenta-1,3-dien-1-amine (PubChem CID 142425146) has the molecular formula C34H29N and a molecular weight of 451.61 g/mol. Its IUPAC name is (1Z,3E)-5-[4-(8-methylnaphthalen-1-yl)phenyl]-1,3-diphenylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-5-[4-(8-methylnaphthalen-1-yl)phenyl]-1,3-diphenylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142425146 |
| Molecular Formula | C34H29N |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | (1Z,3E)-5-[4-(8-methylnaphthalen-1-yl)phenyl]-1,3-diphenylpenta-1,3-dien-1-amine |
| SMILES | Cc1cccc2cccc(-c3ccc(C/C=C(\C=C(/N)c4ccccc4)c4ccccc4)cc3)c12 |
| InChI | InChI=1S/C34H29N/c1-25-10-8-15-30-16-9-17-32(34(25)30)28-21-18-26(19-22-28)20-23-31(27-11-4-2-5-12-27)24-33(35)29-13-6-3-7-14-29/h2-19,21-24H,20,35H2,1H3/b31-23+,33-24- |
| InChIKey | ZUGUYGIHZUOTGQ-FRLFPXTKSA-N |
| XLogP | 8.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|