C25H27N — CID 143239983
(2E,4Z,6E,8Z)-9-methyl-1-(4-methylphenyl)-3-phenylundeca-2,4,6,8,10-pentaen-5-amine (PubChem CID 143239983) has the molecular formula C25H27N and a molecular weight of 341.50 g/mol. Its IUPAC name is (2E,4Z,6E,8Z)-9-methyl-1-(4-methylphenyl)-3-phenylundeca-2,4,6,8,10-pentaen-5-amine.
| Compound Name | (2E,4Z,6E,8Z)-9-methyl-1-(4-methylphenyl)-3-phenylundeca-2,4,6,8,10-pentaen-5-amine |
|---|---|
| PubChem CID | 143239983 |
| Molecular Formula | C25H27N |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (2E,4Z,6E,8Z)-9-methyl-1-(4-methylphenyl)-3-phenylundeca-2,4,6,8,10-pentaen-5-amine |
| SMILES | C=C/C(C)=C\C=C\C(N)=C\C(=C/Cc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N/c1-4-20(2)9-8-12-25(26)19-24(23-10-6-5-7-11-23)18-17-22-15-13-21(3)14-16-22/h4-16,18-19H,1,17,26H2,2-3H3/b12-8+,20-9-,24-18+,25-19- |
| InChIKey | RNOXDKRIMKDULP-CODIFIRQSA-N |
| XLogP | 6.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|