C11H11Br — CID 101147741
[(2Z)-3-bromopenta-2,4-dienyl]benzene (PubChem CID 101147741) has the molecular formula C11H11Br and a molecular weight of 223.11 g/mol. Its IUPAC name is [(2Z)-3-bromopenta-2,4-dienyl]benzene.
| Compound Name | [(2Z)-3-bromopenta-2,4-dienyl]benzene |
|---|---|
| PubChem CID | 101147741 |
| Molecular Formula | C11H11Br |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | [(2Z)-3-bromopenta-2,4-dienyl]benzene |
| SMILES | C=C/C(Br)=C/Cc1ccccc1 |
| InChI | InChI=1S/C11H11Br/c1-2-11(12)9-8-10-6-4-3-5-7-10/h2-7,9H,1,8H2/b11-9- |
| InChIKey | PQQJBFZEXJLMNC-LUAWRHEFSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|