C14H17BrO — CID 101047843
[(4Z)-5-bromo-2-methoxyhepta-4,6-dienyl]benzene (PubChem CID 101047843) has the molecular formula C14H17BrO and a molecular weight of 281.19 g/mol. Its IUPAC name is [(4Z)-5-bromo-2-methoxyhepta-4,6-dienyl]benzene.
| Compound Name | [(4Z)-5-bromo-2-methoxyhepta-4,6-dienyl]benzene |
|---|---|
| PubChem CID | 101047843 |
| Molecular Formula | C14H17BrO |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | [(4Z)-5-bromo-2-methoxyhepta-4,6-dienyl]benzene |
| SMILES | C=C/C(Br)=C/CC(Cc1ccccc1)OC |
| InChI | InChI=1S/C14H17BrO/c1-3-13(15)9-10-14(16-2)11-12-7-5-4-6-8-12/h3-9,14H,1,10-11H2,2H3/b13-9- |
| InChIKey | DPMZURUJIFECSC-LCYFTJDESA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|