C16H16BrNO2 — CID 101047852
benzyl N-[(5Z)-6-bromoocta-5,7-dien-1-yn-3-yl]carbamate (PubChem CID 101047852) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is benzyl N-[(5Z)-6-bromoocta-5,7-dien-1-yn-3-yl]carbamate.
| Compound Name | benzyl N-[(5Z)-6-bromoocta-5,7-dien-1-yn-3-yl]carbamate |
|---|---|
| PubChem CID | 101047852 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | benzyl N-[(5Z)-6-bromoocta-5,7-dien-1-yn-3-yl]carbamate |
| SMILES | C#CC(C/C=C(\Br)C=C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H16BrNO2/c1-3-14(17)10-11-15(4-2)18-16(19)20-12-13-8-6-5-7-9-13/h2-3,5-10,15H,1,11-12H2,(H,18,19)/b14-10- |
| InChIKey | RLCANBZDVBYXSK-UVTDQMKNSA-N |
| XLogP | 3.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|