C14H14Br2O — CID 143253089
[(2E,4E)-3,5-dibromohepta-2,4,6-trienoxy]methylbenzene (PubChem CID 143253089) has the molecular formula C14H14Br2O and a molecular weight of 358.07 g/mol. Its IUPAC name is [(2E,4E)-3,5-dibromohepta-2,4,6-trienoxy]methylbenzene.
| Compound Name | [(2E,4E)-3,5-dibromohepta-2,4,6-trienoxy]methylbenzene |
|---|---|
| PubChem CID | 143253089 |
| Molecular Formula | C14H14Br2O |
| Molecular Weight | 358.07 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | [(2E,4E)-3,5-dibromohepta-2,4,6-trienoxy]methylbenzene |
| SMILES | C=C/C(Br)=C\C(Br)=C/COCc1ccccc1 |
| InChI | InChI=1S/C14H14Br2O/c1-2-13(15)10-14(16)8-9-17-11-12-6-4-3-5-7-12/h2-8,10H,1,9,11H2/b13-10+,14-8+ |
| InChIKey | BIYJCVNCCQJGHH-KGZUQBBUSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.07 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|