C55H51N3 — CID 142425214
(1Z,3E)-3-[4-[5-[4-(1-amino-1-phenylethyl)phenyl]naphthalen-1-yl]phenyl]-1,5-diphenylpenta-1,3-dien-1-amine;methanimine;toluene (PubChem CID 142425214) has the molecular formula C55H51N3 and a molecular weight of 754.03 g/mol. Its IUPAC name is (1Z,3E)-3-[4-[5-[4-(1-amino-1-phenylethyl)phenyl]naphthalen-1-yl]phenyl]-1,5-diphenylpenta-1,3-dien-1-amine;methanimine;toluene.
| Compound Name | (1Z,3E)-3-[4-[5-[4-(1-amino-1-phenylethyl)phenyl]naphthalen-1-yl]phenyl]-1,5-diphenylpenta-1,3-dien-1-amine;methanimine;toluene |
|---|---|
| PubChem CID | 142425214 |
| Molecular Formula | C55H51N3 |
| Molecular Weight | 754.03 g/mol |
| Exact Mass | 753.41 |
| IUPAC Name | (1Z,3E)-3-[4-[5-[4-(1-amino-1-phenylethyl)phenyl]naphthalen-1-yl]phenyl]-1,5-diphenylpenta-1,3-dien-1-amine;methanimine;toluene |
| SMILES | CC(N)(c1ccccc1)c1ccc(-c2cccc3c(-c4ccc(C(/C=C(\N)c5ccccc5)=C/Cc5ccccc5)cc4)cccc23)cc1.Cc1ccccc1.[H]N=C |
| InChI | InChI=1S/C47H40N2.C7H8.CH3N/c1-47(49,40-17-9-4-10-18-40)41-31-29-37(30-32-41)43-20-12-21-44-42(19-11-22-45(43)44)36-27-25-35(26-28-36)39(24-23-34-13-5-2-6-14-34)33-46(48)38-15-7-3-8-16-38;1-7-5-3-2-4-6-7;1-2/h2-22,24-33H,23,48-49H2,1H3;2-6H,1H3;2H,1H2/b39-24+,46-33-;; |
| InChIKey | DLPDPSZKXQCFHT-KZPKHCDNSA-N |
| XLogP | 13.28 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.03 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|