C55H47N — CID 144803314
(1Z,3E)-3-[3-[3-[(E,1E)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-10-methylidenephenanthren-9-ylidene]but-2-en-2-yl]phenyl]phenyl]-1,5-diphenylpenta-1,3-dien-1-amine (PubChem CID 144803314) has the molecular formula C55H47N and a molecular weight of 721.99 g/mol. Its IUPAC name is (1Z,3E)-3-[3-[3-[(E,1E)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-10-methylidenephenanthren-9-ylidene]but-2-en-2-yl]phenyl]phenyl]-1,5-diphenylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-3-[3-[3-[(E,1E)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-10-methylidenephenanthren-9-ylidene]but-2-en-2-yl]phenyl]phenyl]-1,5-diphenylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144803314 |
| Molecular Formula | C55H47N |
| Molecular Weight | 721.99 g/mol |
| Exact Mass | 721.37 |
| IUPAC Name | (1Z,3E)-3-[3-[3-[(E,1E)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-10-methylidenephenanthren-9-ylidene]but-2-en-2-yl]phenyl]phenyl]-1,5-diphenylpenta-1,3-dien-1-amine |
| SMILES | C=C/C=C(\C=C/C)c1ccc2c(=C)/c(=C\C(=C/C)c3cccc(-c4cccc(C(/C=C(\N)c5ccccc5)=C/Cc5ccccc5)c4)c3)c3ccccc3c2c1 |
| InChI | InChI=1S/C55H47N/c1-5-18-42(19-6-2)48-32-33-50-39(4)53(51-28-14-15-29-52(51)54(50)37-48)36-41(7-3)44-24-16-25-45(34-44)46-26-17-27-47(35-46)49(31-30-40-20-10-8-11-21-40)38-55(56)43-22-12-9-13-23-43/h5-29,31-38H,1,4,30,56H2,2-3H3/b19-6-,41-7+,42-18+,49-31+,53-36+,55-38- |
| InChIKey | DZKLOMACIYRXTG-YTSQYLEZSA-N |
| XLogP | 12.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.99 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|