C21H20N4 — CID 143271307
N'-amino-9-[(4-methylphenyl)methyl]carbazole-3-carboximidamide (PubChem CID 143271307) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is N'-amino-9-[(4-methylphenyl)methyl]carbazole-3-carboximidamide.
| Compound Name | N'-amino-9-[(4-methylphenyl)methyl]carbazole-3-carboximidamide |
|---|---|
| PubChem CID | 143271307 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N'-amino-9-[(4-methylphenyl)methyl]carbazole-3-carboximidamide |
| SMILES | Cc1ccc(Cn2c3ccccc3c3cc(/C(N)=N/N)ccc32)cc1 |
| InChI | InChI=1S/C21H20N4/c1-14-6-8-15(9-7-14)13-25-19-5-3-2-4-17(19)18-12-16(21(22)24-23)10-11-20(18)25/h2-12H,13,23H2,1H3,(H2,22,24) |
| InChIKey | ZNTYESPOTQZFGZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|