C27H24N6 — CID 142938358
9-[[4-(2-cyanophenyl)phenyl]methyl]carbazole-3-carboximidamide;hydrazine (PubChem CID 142938358) has the molecular formula C27H24N6 and a molecular weight of 432.53 g/mol. Its IUPAC name is 9-[[4-(2-cyanophenyl)phenyl]methyl]carbazole-3-carboximidamide;hydrazine.
| Compound Name | 9-[[4-(2-cyanophenyl)phenyl]methyl]carbazole-3-carboximidamide;hydrazine |
|---|---|
| PubChem CID | 142938358 |
| Molecular Formula | C27H24N6 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 9-[[4-(2-cyanophenyl)phenyl]methyl]carbazole-3-carboximidamide;hydrazine |
| SMILES | NN.[H]/N=C(\N)c1ccc2c(c1)c1ccccc1n2Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C27H20N4.H4N2/c28-16-21-5-1-2-6-22(21)19-11-9-18(10-12-19)17-31-25-8-4-3-7-23(25)24-15-20(27(29)30)13-14-26(24)31;1-2/h1-15H,17H2,(H3,29,30);1-2H2 |
| InChIKey | JGPLCIIAVSJDLV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|