C28H24N4O — CID 163863733
9-[[4-(4-ethoxyphenyl)phenyl]methyl]-N-iminocarbazole-3-carboximidamide (PubChem CID 163863733) has the molecular formula C28H24N4O and a molecular weight of 432.53 g/mol. Its IUPAC name is 9-[[4-(4-ethoxyphenyl)phenyl]methyl]-N-iminocarbazole-3-carboximidamide.
| Compound Name | 9-[[4-(4-ethoxyphenyl)phenyl]methyl]-N-iminocarbazole-3-carboximidamide |
|---|---|
| PubChem CID | 163863733 |
| Molecular Formula | C28H24N4O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 9-[[4-(4-ethoxyphenyl)phenyl]methyl]-N-iminocarbazole-3-carboximidamide |
| SMILES | [H]/N=C(\N=N\[H])c1ccc2c(c1)c1ccccc1n2Cc1ccc(-c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C28H24N4O/c1-2-33-23-14-11-21(12-15-23)20-9-7-19(8-10-20)18-32-26-6-4-3-5-24(26)25-17-22(28(29)31-30)13-16-27(25)32/h3-17,29-30H,2,18H2,1H3/b29-28-,31-30+ |
| InChIKey | FNUDJDKDBTYSDE-GILIAAGRSA-N |
| XLogP | 7.26 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|