C20H16ClN5 — CID 142223725
9-[(2-chlorophenyl)methyl]-N-hydrazinylidenecarbazole-3-carboximidamide (PubChem CID 142223725) has the molecular formula C20H16ClN5 and a molecular weight of 361.84 g/mol. Its IUPAC name is 9-[(2-chlorophenyl)methyl]-N-hydrazinylidenecarbazole-3-carboximidamide.
| Compound Name | 9-[(2-chlorophenyl)methyl]-N-hydrazinylidenecarbazole-3-carboximidamide |
|---|---|
| PubChem CID | 142223725 |
| Molecular Formula | C20H16ClN5 |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 9-[(2-chlorophenyl)methyl]-N-hydrazinylidenecarbazole-3-carboximidamide |
| SMILES | [H]/N=C(\N=N\N)c1ccc2c(c1)c1ccccc1n2Cc1ccccc1Cl |
| InChI | InChI=1S/C20H16ClN5/c21-17-7-3-1-5-14(17)12-26-18-8-4-2-6-15(18)16-11-13(9-10-19(16)26)20(22)24-25-23/h1-11H,12H2,(H3,22,23,24) |
| InChIKey | BQAVMIAGXGVUNJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|