C22H14F6N4 — CID 142223631
9-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-iminocarbazole-3-carboximidamide (PubChem CID 142223631) has the molecular formula C22H14F6N4 and a molecular weight of 448.37 g/mol. Its IUPAC name is 9-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-iminocarbazole-3-carboximidamide.
| Compound Name | 9-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-iminocarbazole-3-carboximidamide |
|---|---|
| PubChem CID | 142223631 |
| Molecular Formula | C22H14F6N4 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 9-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-iminocarbazole-3-carboximidamide |
| SMILES | [H]/N=C(\N=N\[H])c1ccc2c(c1)c1ccccc1n2Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H14F6N4/c23-21(24,25)14-7-12(8-15(10-14)22(26,27)28)11-32-18-4-2-1-3-16(18)17-9-13(20(29)31-30)5-6-19(17)32/h1-10,29-30H,11H2/b29-20-,31-30+ |
| InChIKey | YKUOUVSXFUQESZ-PRNCLZLASA-N |
| XLogP | 7.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|