About N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole
N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole (PubChem CID 143165525) has the molecular formula C22H22N4
and a molecular weight of 342.45 g/mol. Its IUPAC name is N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole.
Molecular Properties
| Compound Name | N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole |
| PubChem CID | 143165525 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole |
| SMILES | Cc1ccc(Cn2c3ccccc3c3ccccc32)cc1.[H]/N=N/C(C)=N/[H] |
| InChI | InChI=1S/C20H17N.C2H5N3/c1-15-10-12-16(13-11-15)14-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21;1-2(3)5-4/h2-13H,14H2,1H3;3-4H,1H3/b;3-2+,5-4+ |
| InChIKey | OGNNPSQBDYVSQJ-PLKIVWSFSA-N |
| XLogP | 6.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole?
The IUPAC name of N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole (CID 143165525) is N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole.
What is the SMILES notation for N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole?
The canonical SMILES for N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole is Cc1ccc(Cn2c3ccccc3c3ccccc32)cc1.[H]/N=N/C(C)=N/[H].
What is the InChIKey of N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole?
The InChIKey is OGNNPSQBDYVSQJ-PLKIVWSFSA-N. The full InChI is InChI=1S/C20H17N.C2H5N3/c1-15-10-12-16(13-11-15)14-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21;1-2(3)5-4/h2-13H,14H2,1H3;3-4H,1H3/b;3-2+,5-4+.
What are the key properties of N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole?
N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole has a molecular weight of 342.45 g/mol, XLogP of 6.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-iminoethanimidamide;9-[(4-methylphenyl)methyl]carbazole is sourced from PubChem (CID 143165525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).