C23H24N5+ — CID 142938701
[(aminodiazenyl)-[9-[(2,4,6-trimethylphenyl)methyl]carbazol-3-yl]methylidene]azanium (PubChem CID 142938701) has the molecular formula C23H24N5+ and a molecular weight of 370.48 g/mol. Its IUPAC name is [(aminodiazenyl)-[9-[(2,4,6-trimethylphenyl)methyl]carbazol-3-yl]methylidene]azanium.
| Compound Name | [(aminodiazenyl)-[9-[(2,4,6-trimethylphenyl)methyl]carbazol-3-yl]methylidene]azanium |
|---|---|
| PubChem CID | 142938701 |
| Molecular Formula | C23H24N5+ |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [(aminodiazenyl)-[9-[(2,4,6-trimethylphenyl)methyl]carbazol-3-yl]methylidene]azanium |
| SMILES | Cc1cc(C)c(Cn2c3ccccc3c3cc(C(=[NH2+])/N=N/N)ccc32)c(C)c1 |
| InChI | InChI=1S/C23H23N5/c1-14-10-15(2)20(16(3)11-14)13-28-21-7-5-4-6-18(21)19-12-17(8-9-22(19)28)23(24)26-27-25/h4-12H,13H2,1-3H3,(H3,24,25,26)/p+1 |
| InChIKey | DGOHTASKMVZBJF-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|