C24H19N3O — CID 19087819
2-[4-[(2-ethyl-4-oxoquinazolin-1-yl)methyl]phenyl]benzonitrile (PubChem CID 19087819) has the molecular formula C24H19N3O and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[4-[(2-ethyl-4-oxoquinazolin-1-yl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(2-ethyl-4-oxoquinazolin-1-yl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 19087819 |
| Molecular Formula | C24H19N3O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[4-[(2-ethyl-4-oxoquinazolin-1-yl)methyl]phenyl]benzonitrile |
| SMILES | CCc1nc(=O)c2ccccc2n1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C24H19N3O/c1-2-23-26-24(28)21-9-5-6-10-22(21)27(23)16-17-11-13-18(14-12-17)20-8-4-3-7-19(20)15-25/h3-14H,2,16H2,1H3 |
| InChIKey | IJMUXWKVBWCNBG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |