C21H18N2O — CID 19012285
2-[4-[(2-ethyl-6-oxo-1-pyridinyl)methyl]phenyl]benzonitrile (PubChem CID 19012285) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-[4-[(2-ethyl-6-oxo-1-pyridinyl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(2-ethyl-6-oxo-1-pyridinyl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 19012285 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-[4-[(2-ethyl-6-oxo-1-pyridinyl)methyl]phenyl]benzonitrile |
| SMILES | CCc1cccc(=O)n1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C21H18N2O/c1-2-19-7-5-9-21(24)23(19)15-16-10-12-17(13-11-16)20-8-4-3-6-18(20)14-22/h3-13H,2,15H2,1H3 |
| InChIKey | ZWBDFURQASIREB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |