C26H27N3O — CID 57460071
2-[4-[(5-cyclopropyl-4-ethyl-6-oxo-2-propylpyrimidin-1-yl)methyl]phenyl]benzonitrile (PubChem CID 57460071) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[4-[(5-cyclopropyl-4-ethyl-6-oxo-2-propylpyrimidin-1-yl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(5-cyclopropyl-4-ethyl-6-oxo-2-propylpyrimidin-1-yl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 57460071 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-[4-[(5-cyclopropyl-4-ethyl-6-oxo-2-propylpyrimidin-1-yl)methyl]phenyl]benzonitrile |
| SMILES | CCCc1nc(CC)c(C2CC2)c(=O)n1Cc1ccc(-c2ccccc2C#N)cc1 |
| InChI | InChI=1S/C26H27N3O/c1-3-7-24-28-23(4-2)25(20-14-15-20)26(30)29(24)17-18-10-12-19(13-11-18)22-9-6-5-8-21(22)16-27/h5-6,8-13,20H,3-4,7,14-15,17H2,1-2H3 |
| InChIKey | HSWNWXVYBMTGDA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |