C21H19N5O — CID 154537128
N'-diazenyl-9-[(3-methoxyphenyl)methyl]carbazole-3-carboximidamide (PubChem CID 154537128) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is N'-diazenyl-9-[(3-methoxyphenyl)methyl]carbazole-3-carboximidamide.
| Compound Name | N'-diazenyl-9-[(3-methoxyphenyl)methyl]carbazole-3-carboximidamide |
|---|---|
| PubChem CID | 154537128 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N'-diazenyl-9-[(3-methoxyphenyl)methyl]carbazole-3-carboximidamide |
| SMILES | [H]/N=N/N=C(N)c1ccc2c(c1)c1ccccc1n2Cc1cccc(OC)c1 |
| InChI | InChI=1S/C21H19N5O/c1-27-16-6-4-5-14(11-16)13-26-19-8-3-2-7-17(19)18-12-15(9-10-20(18)26)21(22)24-25-23/h2-12H,13H2,1H3,(H3,22,23,24) |
| InChIKey | DILOFSMDYAJHNG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|