C34H25ClO7 — CID 173460835
4-(chromenylium-4-ylmethylidene)-2-[2-(4-methoxyphenyl)-2-phenylethenyl]chromene perchlorate (PubChem CID 173460835) has the molecular formula C34H25ClO7 and a molecular weight of 581.02 g/mol. Its IUPAC name is 4-(chromenylium-4-ylmethylidene)-2-[2-(4-methoxyphenyl)-2-phenylethenyl]chromene perchlorate.
| Compound Name | 4-(chromenylium-4-ylmethylidene)-2-[2-(4-methoxyphenyl)-2-phenylethenyl]chromene perchlorate |
|---|---|
| PubChem CID | 173460835 |
| Molecular Formula | C34H25ClO7 |
| Molecular Weight | 581.02 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | 4-(chromenylium-4-ylmethylidene)-2-[2-(4-methoxyphenyl)-2-phenylethenyl]chromene perchlorate |
| SMILES | COc1ccc(C(=CC2=CC(=Cc3cc[o+]c4ccccc34)c3ccccc3O2)c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C34H25O3.ClHO4/c1-35-28-17-15-25(16-18-28)32(24-9-3-2-4-10-24)23-29-22-27(31-12-6-8-14-34(31)37-29)21-26-19-20-36-33-13-7-5-11-30(26)33;2-1(3,4)5/h2-23H,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | NMDZFGHZUZBFRZ-UHFFFAOYSA-M |
| XLogP | 3.92 |
| TPSA | 122.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.02 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|