About (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone
(2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone (PubChem CID 134868144) has the molecular formula C29H20O2
and a molecular weight of 400.48 g/mol. Its IUPAC name is (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone.
Molecular Properties
| Compound Name | (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone |
| PubChem CID | 134868144 |
| Molecular Formula | C29H20O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone |
| SMILES | O=C(/C(=C1\C=C(c2ccccc2)Oc2ccccc21)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H20O2/c30-29(23-16-8-3-9-17-23)28(22-14-6-2-7-15-22)25-20-27(21-12-4-1-5-13-21)31-26-19-11-10-18-24(25)26/h1-20H/b28-25+ |
| InChIKey | ULZJERXYXQHWPA-AZPGRJICSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone?
The IUPAC name of (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone (CID 134868144) is (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone.
What is the SMILES notation for (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone?
The canonical SMILES for (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone is O=C(/C(=C1\C=C(c2ccccc2)Oc2ccccc21)c1ccccc1)c1ccccc1.
What is the InChIKey of (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone?
The InChIKey is ULZJERXYXQHWPA-AZPGRJICSA-N. The full InChI is InChI=1S/C29H20O2/c30-29(23-16-8-3-9-17-23)28(22-14-6-2-7-15-22)25-20-27(21-12-4-1-5-13-21)31-26-19-11-10-18-24(25)26/h1-20H/b28-25+.
What are the key properties of (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone?
(2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone has a molecular weight of 400.48 g/mol, XLogP of 6.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1,2-diphenyl-2-(2-phenylchromen-4-ylidene)ethanone is sourced from PubChem (CID 134868144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).