C23H19O2+ — CID 137292692
(4Z)-4-[(2,6-dimethylpyrylium-4-yl)methylidene]-2-phenylchromene (PubChem CID 137292692) has the molecular formula C23H19O2+ and a molecular weight of 327.40 g/mol. Its IUPAC name is (4Z)-4-[(2,6-dimethylpyrylium-4-yl)methylidene]-2-phenylchromene.
| Compound Name | (4Z)-4-[(2,6-dimethylpyrylium-4-yl)methylidene]-2-phenylchromene |
|---|---|
| PubChem CID | 137292692 |
| Molecular Formula | C23H19O2+ |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (4Z)-4-[(2,6-dimethylpyrylium-4-yl)methylidene]-2-phenylchromene |
| SMILES | Cc1cc(/C=C2/C=C(c3ccccc3)Oc3ccccc32)cc(C)[o+]1 |
| InChI | InChI=1S/C23H19O2/c1-16-12-18(13-17(2)24-16)14-20-15-23(19-8-4-3-5-9-19)25-22-11-7-6-10-21(20)22/h3-15H,1-2H3/q+1 |
| InChIKey | KDXWOEFZYRZQEK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|