C28H18O4 — CID 175371588
1,2-diphenylethane-1,2-dione;phenanthrene-9,10-dione (PubChem CID 175371588) has the molecular formula C28H18O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-dione;phenanthrene-9,10-dione.
| Compound Name | 1,2-diphenylethane-1,2-dione;phenanthrene-9,10-dione |
|---|---|
| PubChem CID | 175371588 |
| Molecular Formula | C28H18O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione;phenanthrene-9,10-dione |
| SMILES | O=C(C(=O)c1ccccc1)c1ccccc1.O=C1C(=O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H8O2.C14H10O2/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16;15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-8H;1-10H |
| InChIKey | OABIXKOYDYLSHM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|