C26H20O2 — CID 5074511
4-[2-(4-methoxyphenyl)ethenylidene]-2,6-diphenylpyran (PubChem CID 5074511) has the molecular formula C26H20O2 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)ethenylidene]-2,6-diphenylpyran.
| Compound Name | 4-[2-(4-methoxyphenyl)ethenylidene]-2,6-diphenylpyran |
|---|---|
| PubChem CID | 5074511 |
| Molecular Formula | C26H20O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)ethenylidene]-2,6-diphenylpyran |
| SMILES | COc1ccc(C=C=C2C=C(c3ccccc3)OC(c3ccccc3)=C2)cc1 |
| InChI | InChI=1S/C26H20O2/c1-27-24-16-14-20(15-17-24)12-13-21-18-25(22-8-4-2-5-9-22)28-26(19-21)23-10-6-3-7-11-23/h2-12,14-19H,1H3 |
| InChIKey | WZBARJGXQUJNDD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |