C29H23O2P — CID 164684424
4-methyl-2,6-bis(4-phenylphenyl)-1,4λ5-oxaphosphinine 4-oxide (PubChem CID 164684424) has the molecular formula C29H23O2P and a molecular weight of 434.48 g/mol. Its IUPAC name is 4-methyl-2,6-bis(4-phenylphenyl)-1,4λ5-oxaphosphinine 4-oxide.
| Compound Name | 4-methyl-2,6-bis(4-phenylphenyl)-1,4λ5-oxaphosphinine 4-oxide |
|---|---|
| PubChem CID | 164684424 |
| Molecular Formula | C29H23O2P |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 4-methyl-2,6-bis(4-phenylphenyl)-1,4λ5-oxaphosphinine 4-oxide |
| SMILES | CP1(=O)C=C(c2ccc(-c3ccccc3)cc2)OC(c2ccc(-c3ccccc3)cc2)=C1 |
| InChI | InChI=1S/C29H23O2P/c1-32(30)20-28(26-16-12-24(13-17-26)22-8-4-2-5-9-22)31-29(21-32)27-18-14-25(15-19-27)23-10-6-3-7-11-23/h2-21H,1H3 |
| InChIKey | YCYKKZZLZKNYQL-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|