C38H54O2S2 — CID 140765625
4-[[2,6-bis(3,3-dimethylbutyl)thiopyrylium-4-yl]methylidene]-2-[[2,6-bis(3-methylbutyl)thiopyran-4-ylidene]methyl]-3-oxocyclobuten-1-olate (PubChem CID 140765625) has the molecular formula C38H54O2S2 and a molecular weight of 606.98 g/mol. Its IUPAC name is 4-[[2,6-bis(3,3-dimethylbutyl)thiopyrylium-4-yl]methylidene]-2-[[2,6-bis(3-methylbutyl)thiopyran-4-ylidene]methyl]-3-oxocyclobuten-1-olate.
| Compound Name | 4-[[2,6-bis(3,3-dimethylbutyl)thiopyrylium-4-yl]methylidene]-2-[[2,6-bis(3-methylbutyl)thiopyran-4-ylidene]methyl]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 140765625 |
| Molecular Formula | C38H54O2S2 |
| Molecular Weight | 606.98 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | 4-[[2,6-bis(3,3-dimethylbutyl)thiopyrylium-4-yl]methylidene]-2-[[2,6-bis(3-methylbutyl)thiopyran-4-ylidene]methyl]-3-oxocyclobuten-1-olate |
| SMILES | CC(C)CCC1=CC(=CC2=C([O-])C(=Cc3cc(CCC(C)(C)C)[s+]c(CCC(C)(C)C)c3)C2=O)C=C(CCC(C)C)S1 |
| InChI | InChI=1S/C38H54O2S2/c1-25(2)11-13-29-19-27(20-30(41-29)14-12-26(3)4)23-33-35(39)34(36(33)40)24-28-21-31(15-17-37(5,6)7)42-32(22-28)16-18-38(8,9)10/h19-26H,11-18H2,1-10H3 |
| InChIKey | PLQNAZGJFXFCHA-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.98 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|