C36H50O2S2 — CID 140765627
2-[[2,6-bis(3,3-dimethylbutyl)thiopyran-4-ylidene]methyl]-4-[(2,6-ditert-butylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate (PubChem CID 140765627) has the molecular formula C36H50O2S2 and a molecular weight of 578.93 g/mol. Its IUPAC name is 2-[[2,6-bis(3,3-dimethylbutyl)thiopyran-4-ylidene]methyl]-4-[(2,6-ditert-butylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | 2-[[2,6-bis(3,3-dimethylbutyl)thiopyran-4-ylidene]methyl]-4-[(2,6-ditert-butylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 140765627 |
| Molecular Formula | C36H50O2S2 |
| Molecular Weight | 578.93 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | 2-[[2,6-bis(3,3-dimethylbutyl)thiopyran-4-ylidene]methyl]-4-[(2,6-ditert-butylthiopyrylium-4-yl)methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CC(C)(C)CCC1=CC(=CC2=C([O-])C(=Cc3cc(C(C)(C)C)[s+]c(C(C)(C)C)c3)C2=O)C=C(CCC(C)(C)C)S1 |
| InChI | InChI=1S/C36H50O2S2/c1-33(2,3)15-13-25-17-23(18-26(39-25)14-16-34(4,5)6)19-27-31(37)28(32(27)38)20-24-21-29(35(7,8)9)40-30(22-24)36(10,11)12/h17-22H,13-16H2,1-12H3 |
| InChIKey | UUWTYCMWWKIMBQ-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.93 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|